CAS 926201-88-9 appears in our catalog under these names: 3-(3,4-Dichlorophenyl)aniline, 96%, 3-(3,4-Dichlorophenyl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
3-(3,4-dichlorophenyl)aniline (CAS 926201-88-9) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)aniline. InChIKey: QAIPUZXPASEOTL-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)aniline |
| InChIKey | QAIPUZXPASEOTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)