CAS 405058-01-7 appears in our catalog under these names: 4-Amino-3',5'-dichlorobiphenyl, 95%, 3',5'-Dichloro-(1,1'-biphenyl)-4-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
4-(3,5-dichlorophenyl)aniline (CAS 405058-01-7) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 4-(3,5-dichlorophenyl)aniline. InChIKey: IELLSGLWKOTCFM-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 4-(3,5-dichlorophenyl)aniline |
| InChIKey | IELLSGLWKOTCFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)Cl)Cl)N |
Computed by PubChem (NCBI)