cas: 2183577-00-4 — see every product listed under this CAS number, including other names
7-(2-Aminoethoxy)-2H-chromen-2-one Hydrochloride, ≥95%, ≥95% (CAS 2183577-00-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12TC10-250mg |
| cas | 2183577-00-4 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2114.00 Pln | |
| Chemat | 10g | 3544.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
7-(2-aminoethoxy)chromen-2-one;hydrochloride (CAS 2183577-00-4) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: 7-(2-aminoethoxy)chromen-2-one;hydrochloride. InChIKey: VYZOEHADOQYBOP-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 7-(2-aminoethoxy)chromen-2-one;hydrochloride |
| InChIKey | VYZOEHADOQYBOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=O)O2)OCCN.Cl |
Computed by PubChem (NCBI)