CAS 68281-43-6 is the registry number for Ethyl 6-chloro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate (CAS 68281-43-6) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: ethyl 6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate. InChIKey: YQUPYAAIKGIVAV-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | ethyl 6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate |
| InChIKey | YQUPYAAIKGIVAV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNC2=C(O1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)