cas: 915411-02-8 — see every product listed under this CAS number, including other names
7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole 97% (CAS 915411-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A710145-100mg |
| cas | 915411-02-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 926.62 Pln | |
| Ambeed | 25g | 3090.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A710145 |
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (CAS 915411-02-8) is a chemical compound with the molecular formula C13H17BN2O2 and a molecular weight of 244.10 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole. InChIKey: KZRYMNAPWVDMDN-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O2 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| InChIKey | KZRYMNAPWVDMDN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=NN3 |
Computed by PubChem (NCBI)