cas: 53985-75-4 — see every product listed under this CAS number, including other names
7-(Trifluoromethoxy)quinolin-4-ol, 98% (CAS 53985-75-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239359-250MG |
| cas | 53985-75-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 1325.59 Pln | |
| Fluorochem | 10g | 2601.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
7-(trifluoromethoxy)-1H-quinolin-4-one (CAS 53985-75-4) is a chemical compound with the molecular formula C10H6F3NO2 and a molecular weight of 229.15 g/mol. IUPAC name: 7-(trifluoromethoxy)-1H-quinolin-4-one. InChIKey: AULSFKAITWRAMK-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | 7-(trifluoromethoxy)-1H-quinolin-4-one |
| InChIKey | AULSFKAITWRAMK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)NC=CC2=O |
Computed by PubChem (NCBI)