7-(tert-Butoxy)-7-oxoheptanoic acid, 98%
cas: 1469894-57-2 — see every product listed under this CAS number, including other names
7-(tert-Butoxy)-7-oxoheptanoic acid, 98% (CAS 1469894-57-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g, 10g, 5g, 1g, 50g. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | HD-6137-250mg |
| cas | 1469894-57-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 993.38 Pln | |
| Ambeed | 10g | 1761.00 Pln | |
| Ambeed | 25g | 3324.06 Pln | |
| BLDpharm | 250mg | 281.04 Pln | |
| BLDpharm | 1g | 325.47 Pln | |
| BLDpharm | 5g | 1069.65 Pln | |
| BLDpharm | 25g | 3579.88 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 429.20 Pln | |
| Chemat | 10g | 731.60 Pln | |
| Chemat | 25g | 1715.60 Pln | |
| Chemat | 50g | 3040.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid (CAS 1469894-57-2) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: 7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid. InChIKey: QUTDCEYUFAPSIR-UHFFFAOYSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid |
| InChIKey | QUTDCEYUFAPSIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCCC(=O)O |
Computed by PubChem (NCBI)