CAS 1469894-57-2 appears in our catalog under these names: 7-(tert-Butoxy)-7-oxoheptanoic acid, 98%, 7–(tert–Butoxy)–7–oxoheptanoic acid, 7-(Tert-Butoxy)-7-oxoheptanoic acid, 98%, 98%, 7-(tert-Butoxy)-7-oxoheptanoic acid, 99.35%, 7-(tert-Butoxy)-7-oxoheptanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 25g, 10g, 5g, 1g, 50g, 1 g, 500 mg.
7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid (CAS 1469894-57-2) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: 7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid. InChIKey: QUTDCEYUFAPSIR-UHFFFAOYSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid |
| InChIKey | QUTDCEYUFAPSIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCCC(=O)O |
Computed by PubChem (NCBI)