CAS 1621321-22-9 is the registry number for 2-(Ethoxycarbonyl)-3,3,4-trimethylpentanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethoxycarbonyl-3,3,4-trimethylpentanoic acid (CAS 1621321-22-9) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: 2-ethoxycarbonyl-3,3,4-trimethylpentanoic acid. InChIKey: XTDBEHSVVQBLAU-UHFFFAOYSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 2-ethoxycarbonyl-3,3,4-trimethylpentanoic acid |
| InChIKey | XTDBEHSVVQBLAU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)O)C(C)(C)C(C)C |
Computed by PubChem (NCBI)