Products 1621321-22-9

CAS 1621321-22-9 is the registry number for 2-(Ethoxycarbonyl)-3,3,4-trimethylpentanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-ethoxycarbonyl-3,3,4-trimethylpentanoic acid (CAS 1621321-22-9) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: 2-ethoxycarbonyl-3,3,4-trimethylpentanoic acid. InChIKey: XTDBEHSVVQBLAU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20O4
Molecular weight216.27 g/mol
IUPAC name2-ethoxycarbonyl-3,3,4-trimethylpentanoic acid
InChIKeyXTDBEHSVVQBLAU-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(=O)O)C(C)(C)C(C)C

Computed by PubChem (NCBI)