CAS 2941-45-9 appears in our catalog under these names: 2,2,6,6-Tetramethylpimelic acid, 95%, 2,2,6,6-Tetramethylheptanedioic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
2,2,6,6-tetramethylheptanedioic acid (CAS 2941-45-9) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: 2,2,6,6-tetramethylheptanedioic acid. InChIKey: CKUJONFLPBQEKM-UHFFFAOYSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 2,2,6,6-tetramethylheptanedioic acid |
| InChIKey | CKUJONFLPBQEKM-UHFFFAOYSA-N |
| SMILES | CC(C)(CCCC(C)(C)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)