CAS 134807-43-5 appears in our catalog under these names: (S)-4-(tert-Butoxy)-2-isopropyl-4-oxobutanoic acid, 95%, Brivaracetam Impurity 17, (S)–4–(TERT–BUTOXY)–2–ISOPROPYL–4–OXOBUTANOIC ACID, (S)-4-(TERT-BUTOXY)-2-ISOPROPYL-4-OXOBUTANOIC ACID, 98%, 98%, (S)-4-(tert-Butoxy)-2-isopropyl-4-oxobutanoic acid, 98%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, on request, 100mg, 5g.
(2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-propan-2-ylbutanoic acid (CAS 134807-43-5) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-propan-2-ylbutanoic acid. InChIKey: QMCJVFYCDSYHGW-QMMMGPOBSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-propan-2-ylbutanoic acid |
| InChIKey | QMCJVFYCDSYHGW-QMMMGPOBSA-N |
| SMILES | CC(C)[C@H](CC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)