cas: 289483-87-0 — see every product listed under this CAS number, including other names
7-Amino-4-methyl-1H-indole-3-carbonitrile, 98%, 98% (CAS 289483-87-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113X6H-50mg |
| cas | 289483-87-0 |
| size | 50mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 112.40 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 500mg | 352.40 Pln | |
| Chemat | 1g | 544.40 Pln | |
| Chemat | 5g | 1648.40 Pln | |
| Chemat | 10g | 2819.60 Pln | |
| Chemat | 25g | 6266.00 Pln | |
| Chemat | 50g | 6698.00 Pln | |
| Chemat | 100g | 11426.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-amino-4-methyl-1H-indole-3-carbonitrile (CAS 289483-87-0) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 7-amino-4-methyl-1H-indole-3-carbonitrile. InChIKey: SHVBJIBHAKCNMY-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 7-amino-4-methyl-1H-indole-3-carbonitrile |
| InChIKey | SHVBJIBHAKCNMY-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CNC2=C(C=C1)N)C#N |
Computed by PubChem (NCBI)