cas: 106562-32-7 — see every product listed under this CAS number, including other names
7-Amino-4-methylcoumarin-3-acetic Acid, >95.0%(HPLC)(T) (CAS 106562-32-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2820-50MG |
| cas | 106562-32-7 |
| size | 50mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 50mg | 197.02 Pln | |
| TCI | 250mg | 585.48 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC)(T) |
2-(7-amino-4-methyl-2-oxochromen-3-yl)acetic acid (CAS 106562-32-7) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2-(7-amino-4-methyl-2-oxochromen-3-yl)acetic acid. InChIKey: QEQDLKUMPUDNPG-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-(7-amino-4-methyl-2-oxochromen-3-yl)acetic acid |
| InChIKey | QEQDLKUMPUDNPG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)N)CC(=O)O |
Computed by PubChem (NCBI)