cas: 1694132-58-5 — see every product listed under this CAS number, including other names
7-Bromo-2',3',5',6'-tetrahydrospiro(indoline-3,4'-pyran)-2-one, 98% (CAS 1694132-58-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A2256066-1g |
| cas | 1694132-58-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 15303.40 Pln | |
| AmBeed | 250mg | 6163.36 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-bromospiro[1H-indole-3,4'-oxane]-2-one (CAS 1694132-58-5) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: 7-bromospiro[1H-indole-3,4'-oxane]-2-one. InChIKey: QGABJZKATUVAQY-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 7-bromospiro[1H-indole-3,4'-oxane]-2-one |
| InChIKey | QGABJZKATUVAQY-UHFFFAOYSA-N |
| SMILES | C1COCCC12C3=C(C(=CC=C3)Br)NC2=O |
Computed by PubChem (NCBI)