cas: 78863-99-7 — see every product listed under this CAS number, including other names
7-Bromo-2,3,4,9-Tetrahydro-1H-Carbazole, 95%, 95% (CAS 78863-99-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GH0G-100mg |
| cas | 78863-99-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 1019.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-bromo-2,3,4,9-tetrahydro-1H-carbazole (CAS 78863-99-7) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 7-bromo-2,3,4,9-tetrahydro-1H-carbazole. InChIKey: ZNEUGUWVPAHTNJ-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 7-bromo-2,3,4,9-tetrahydro-1H-carbazole |
| InChIKey | ZNEUGUWVPAHTNJ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N2)C=C(C=C3)Br |
Computed by PubChem (NCBI)