cas: 959237-68-4 — see every product listed under this CAS number, including other names
7-Bromo-2,4-dichloroquinazoline, 98%, 98% (CAS 959237-68-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NDJ-100mg |
| cas | 959237-68-4 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 578.00 Pln | |
| Chemat | 25g | 1269.20 Pln | |
| Chemat | 50g | 2267.60 Pln | |
| Chemat | 250g | 8176.40 Pln | |
| Chemat | 500g | 14337.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-bromo-2,4-dichloroquinazoline (CAS 959237-68-4) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 7-bromo-2,4-dichloroquinazoline. InChIKey: RDCSNKDVAPJWGR-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 7-bromo-2,4-dichloroquinazoline |
| InChIKey | RDCSNKDVAPJWGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)