CAS 1504843-40-6 appears in our catalog under these names: 7–Bromo–2–methylimidazo(1,2–a)pyridin–3–amine, 7-Bromo-2-methylimidazo[1,2-a]pyridin-3-amine, 97%, 97%, 7-Bromo-2-methylimidazo[1,2-a]pyridin-3-amine, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-2-methylimidazo[1,2-a]pyridin-3-amine (CAS 1504843-40-6) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 7-bromo-2-methylimidazo[1,2-a]pyridin-3-amine. InChIKey: UDDHZYSARXLARN-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 7-bromo-2-methylimidazo[1,2-a]pyridin-3-amine |
| InChIKey | UDDHZYSARXLARN-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=CC(=CC2=N1)Br)N |
Computed by PubChem (NCBI)