CAS 1500190-82-8 appears in our catalog under these names: 6-Bromo-8-methylimidazo[1,2-a]pyridin-2-amine, 95%, 6-Bromo-8-methylimidazo[1,2-a]pyridin-2-amine 97%, 6-Bromo-8-methylimidazo[1,2-a]pyridin-2-amine, 97%, 97%, 6-Bromo-8-methylimidazo[1,2-a]pyridin-2-amine, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 1g.
6-bromo-8-methylimidazo[1,2-a]pyridin-2-amine (CAS 1500190-82-8) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 6-bromo-8-methylimidazo[1,2-a]pyridin-2-amine. InChIKey: HNXIVIKEZUQSSO-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 6-bromo-8-methylimidazo[1,2-a]pyridin-2-amine |
| InChIKey | HNXIVIKEZUQSSO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NC(=C2)N)Br |
Computed by PubChem (NCBI)