CAS 1403483-69-1 is the registry number for 2-Bromo-4-(1-methylhydrazin-1-yl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
4-[amino(methyl)amino]-2-bromobenzonitrile (CAS 1403483-69-1) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 4-[amino(methyl)amino]-2-bromobenzonitrile. InChIKey: CAJYCBDLTAKZGP-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 4-[amino(methyl)amino]-2-bromobenzonitrile |
| InChIKey | CAJYCBDLTAKZGP-UHFFFAOYSA-N |
| SMILES | CN(C1=CC(=C(C=C1)C#N)Br)N |
Computed by PubChem (NCBI)