CAS 24786-55-8 appears in our catalog under these names: 5-Bromo-1-methyl-1h-1,3-benzodiazol-2-amine, 95%, 5-Bromo-1-methyl-1H-1,3-benzodiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 50mg, 0,5g.
5-bromo-1-methylbenzimidazol-2-amine (CAS 24786-55-8) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 5-bromo-1-methylbenzimidazol-2-amine. InChIKey: AAXWQLLNLMEEQX-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 5-bromo-1-methylbenzimidazol-2-amine |
| InChIKey | AAXWQLLNLMEEQX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)N=C1N |
Computed by PubChem (NCBI)