Products 2377032-46-5

CAS 2377032-46-5 is the registry number for 1,8-Naphthyridin-2-amine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g.

Structural formula: {0} (CAS {1})

1,8-naphthyridin-2-amine;hydrobromide (CAS 2377032-46-5) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 1,8-naphthyridin-2-amine;hydrobromide. InChIKey: YFCCJNIJKLKASH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrN3
Molecular weight226.07 g/mol
IUPAC name1,8-naphthyridin-2-amine;hydrobromide
InChIKeyYFCCJNIJKLKASH-UHFFFAOYSA-N
SMILESC1=CC2=C(N=C1)N=C(C=C2)N.Br

Computed by PubChem (NCBI)