7-Bromo-2-naphthaldehyde, 95%
cas: 627527-17-7 — see every product listed under this CAS number, including other names
7-Bromo-2-naphthaldehyde, 95% (CAS 627527-17-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A854756-250mg |
| cas | 627527-17-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 1032.31 Pln | |
| Ambeed | 5g | 2940.25 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 544.40 Pln | |
| Chemat | 5g | 1576.40 Pln | |
| Chemat | 10g | 2747.60 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 453.20 Pln | |
| BLDpharm | 1g | 1108.52 Pln | |
| BLDpharm | 5g | 3163.36 Pln | |
| BLDpharm | 10g | 4668.38 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
7-bromonaphthalene-2-carbaldehyde (CAS 627527-17-7) is a chemical compound with the molecular formula C11H7BrO and a molecular weight of 235.08 g/mol. IUPAC name: 7-bromonaphthalene-2-carbaldehyde. InChIKey: JJRAGKQULVEFTB-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 7-bromonaphthalene-2-carbaldehyde |
| InChIKey | JJRAGKQULVEFTB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)Br)C=O |
Computed by PubChem (NCBI)
