cas: 1779-11-9 — see every product listed under this CAS number, including other names
7-Bromo-3-hydroxy-2-naphthoic Acid, 98%+, 98%+ (CAS 1779-11-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NDP-1g |
| cas | 1779-11-9 |
| size | 1g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 50g | 280.40 Pln | |
| Chemat | 100g | 496.40 Pln | |
| Chemat | 250g | 1154.00 Pln | |
| Chemat | 500g | 2313.60 Pln | |
| Chemat | 10kg | price on request |
| purity | 98%+ |
|---|---|
| delivery time | 3 weeks |
7-bromo-3-hydroxynaphthalene-2-carboxylic acid (CAS 1779-11-9) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 7-bromo-3-hydroxynaphthalene-2-carboxylic acid. InChIKey: XZWXQSGFZHRDNB-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 7-bromo-3-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | XZWXQSGFZHRDNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC(=C(C=C21)O)C(=O)O)Br |
Computed by PubChem (NCBI)