cas: 1779-11-9 — see every product listed under this CAS number, including other names
7-Bromo-3-hydroxy-naphthalene-2-carboxylic acid, 97% (CAS 1779-11-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 100g, 500g, 1kg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | ST-6509-10g |
| cas | 1779-11-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100g | price on request | |
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 10g | 154.13 Pln | |
| Fluorochem | 25g | 247.85 Pln | |
| Fluorochem | 100g | 737.26 Pln | |
| Fluorochem | 500g | 3423.81 Pln | |
| Fluorochem | 1kg | 6485.23 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
7-bromo-3-hydroxynaphthalene-2-carboxylic acid (CAS 1779-11-9) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 7-bromo-3-hydroxynaphthalene-2-carboxylic acid. InChIKey: XZWXQSGFZHRDNB-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 7-bromo-3-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | XZWXQSGFZHRDNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC(=C(C=C21)O)C(=O)O)Br |
Computed by PubChem (NCBI)