cas: 1260847-61-7 — see every product listed under this CAS number, including other names
7-Bromo-4,6-dichloroquinazoline, 97% (CAS 1260847-61-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A131150-10g |
| cas | 1260847-61-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16677.01 Pln | |
| AmBeed | 5g | 10075.87 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-bromo-4,6-dichloroquinazoline (CAS 1260847-61-7) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 7-bromo-4,6-dichloroquinazoline. InChIKey: NWCDKWJWCZLWQJ-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 7-bromo-4,6-dichloroquinazoline |
| InChIKey | NWCDKWJWCZLWQJ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Br)N=CN=C2Cl |
Computed by PubChem (NCBI)