cas: 1092350-77-0 — see every product listed under this CAS number, including other names
7-Bromo-8-fluorochroman-4-one 95% (CAS 1092350-77-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A993076-100mg |
| cas | 1092350-77-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 1227.00 Pln | |
| Ambeed | 5g | 3769.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A993076 |
7-bromo-8-fluoro-2,3-dihydrochromen-4-one (CAS 1092350-77-0) is a chemical compound with the molecular formula C9H6BrFO2 and a molecular weight of 245.04 g/mol. IUPAC name: 7-bromo-8-fluoro-2,3-dihydrochromen-4-one. InChIKey: KPAFVSLIXPVEOJ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO2 |
|---|---|
| Molecular weight | 245.04 g/mol |
| IUPAC name | 7-bromo-8-fluoro-2,3-dihydrochromen-4-one |
| InChIKey | KPAFVSLIXPVEOJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC(=C2F)Br |
Computed by PubChem (NCBI)