7-Bromoisochroman-4-one, 97%
cas: 168759-64-6 — see every product listed under this CAS number, including other names
7-Bromoisochroman-4-one, 97% (CAS 168759-64-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A330583-250mg |
| cas | 168759-64-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1260.38 Pln | |
| Ambeed | 1g | 3057.06 Pln | |
| Ambeed | 5g | 9025.62 Pln | |
| BLDpharm | 100mg | 869.72 Pln | |
| BLDpharm | 250mg | 1352.88 Pln | |
| BLDpharm | 1g | 3291.09 Pln | |
| BLDpharm | 5g | 9716.60 Pln | |
| Fluorochem | 100mg | 830.98 Pln | |
| Fluorochem | 250mg | 1299.56 Pln | |
| Fluorochem | 500mg | 2116.98 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
7-bromo-1H-isochromen-4-one (CAS 168759-64-6) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 7-bromo-1H-isochromen-4-one. InChIKey: ASAGKWXSKFPRQW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 7-bromo-1H-isochromen-4-one |
| InChIKey | ASAGKWXSKFPRQW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)C(=O)CO1 |
Computed by PubChem (NCBI)