cas: 168759-64-6 — see every product listed under this CAS number, including other names
7-Bromoisochroman-4-one, 97% (CAS 168759-64-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F230612-100MG |
| cas | 168759-64-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 794.53 Pln | |
| Fluorochem | 250mg | 1237.08 Pln | |
| Fluorochem | 500mg | 2033.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-bromo-1H-isochromen-4-one (CAS 168759-64-6) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 7-bromo-1H-isochromen-4-one. InChIKey: ASAGKWXSKFPRQW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 7-bromo-1H-isochromen-4-one |
| InChIKey | ASAGKWXSKFPRQW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)C(=O)CO1 |
Computed by PubChem (NCBI)