7-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95% HPLC
cas: 2728376-32-5 — see every product listed under this CAS number, including other names
7-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95% HPLC (CAS 2728376-32-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1513539-50mg |
| cas | 2728376-32-5 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 765.31 Pln | |
| Ambeed | 250mg | 1939.00 Pln | |
| Ambeed | 1g | 4670.19 Pln | |
| Chemat | 50mg | 760.40 Pln | |
| Chemat | 100mg | 1158.80 Pln | |
| Chemat | 250mg | 1941.20 Pln | |
| Chemat | 1g | 5387.60 Pln | |
| BLDpharm | 50mg | 819.74 Pln | |
| BLDpharm | 100mg | 1247.36 Pln | |
| BLDpharm | 250mg | 2085.96 Pln | |
| BLDpharm | 1g | 5029.36 Pln |
properties
| purity | 95% HPLC |
|---|---|
| delivery time | 2-3 weeks |
7-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2728376-32-5) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 7-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: LPMBHMUUGMNOQY-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 7-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | LPMBHMUUGMNOQY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)