cas: 136549-13-8 — see every product listed under this CAS number, including other names
7-Chloro-2,5-dimethylpyrazolo[1,5-a]pyrimidine 95% (CAS 136549-13-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A159554-100mg |
| cas | 136549-13-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 1093.50 Pln | |
| Ambeed | 5g | 4047.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A159554 |
7-chloro-2,5-dimethylpyrazolo[1,5-a]pyrimidine (CAS 136549-13-8) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 7-chloro-2,5-dimethylpyrazolo[1,5-a]pyrimidine. InChIKey: QGROGNQUPBOMJQ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 7-chloro-2,5-dimethylpyrazolo[1,5-a]pyrimidine |
| InChIKey | QGROGNQUPBOMJQ-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=C1)N=C(C=C2Cl)C |
Computed by PubChem (NCBI)