cas: 136549-13-8 — see every product listed under this CAS number, including other names
7-Chloro-2,5-dimethylpyrazolo[1,5-a]pyrimidine, 97% (CAS 136549-13-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603843-100MG |
| cas | 136549-13-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 784.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-chloro-2,5-dimethylpyrazolo[1,5-a]pyrimidine (CAS 136549-13-8) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 7-chloro-2,5-dimethylpyrazolo[1,5-a]pyrimidine. InChIKey: QGROGNQUPBOMJQ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 7-chloro-2,5-dimethylpyrazolo[1,5-a]pyrimidine |
| InChIKey | QGROGNQUPBOMJQ-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=C1)N=C(C=C2Cl)C |
Computed by PubChem (NCBI)