7-Chloro-5-phenylpyrazolo[1,5-a]pyrimidine, 95%
cas: 33149-25-6 — see every product listed under this CAS number, including other names
7-Chloro-5-phenylpyrazolo[1,5-a]pyrimidine, 95% (CAS 33149-25-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A249192-250mg |
| cas | 33149-25-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1082.38 Pln | |
| Ambeed | 1g | 2667.69 Pln | |
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 894.80 Pln | |
| Chemat | 1g | 2310.80 Pln | |
| BLDpharm | 100mg | 697.56 Pln | |
| BLDpharm | 250mg | 1158.51 Pln | |
| BLDpharm | 1g | 2869.01 Pln | |
| Fluorochem | 100mg | 1013.20 Pln | |
| Fluorochem | 250mg | 1664.02 Pln | |
| Fluorochem | 1g | 4277.68 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
7-chloro-5-phenylpyrazolo[1,5-a]pyrimidine (CAS 33149-25-6) is a chemical compound with the molecular formula C12H8ClN3 and a molecular weight of 229.66 g/mol. IUPAC name: 7-chloro-5-phenylpyrazolo[1,5-a]pyrimidine. InChIKey: UWQMTCYMAVNCQY-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 7-chloro-5-phenylpyrazolo[1,5-a]pyrimidine |
| InChIKey | UWQMTCYMAVNCQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=NN3C(=C2)Cl |
Computed by PubChem (NCBI)