CAS 143426-40-8 is the registry number for 2-(2-Chloro-3-pyridinyl)-1h-1,3-benzimidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(2-chloro-3-pyridinyl)-1H-benzimidazole (CAS 143426-40-8) is a chemical compound with the molecular formula C12H8ClN3 and a molecular weight of 229.66 g/mol. IUPAC name: 2-(2-chloro-3-pyridinyl)-1H-benzimidazole. InChIKey: ZCWQPSLCNFYEIH-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 2-(2-chloro-3-pyridinyl)-1H-benzimidazole |
| InChIKey | ZCWQPSLCNFYEIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=C(N=CC=C3)Cl |
Computed by PubChem (NCBI)