CAS 1844-53-7 is the registry number for 6-Chloro-2-phenylimidazo(1,2-b)pyridazine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-2-phenylimidazo[1,2-b]pyridazine (CAS 1844-53-7) is a chemical compound with the molecular formula C12H8ClN3 and a molecular weight of 229.66 g/mol. IUPAC name: 6-chloro-2-phenylimidazo[1,2-b]pyridazine. InChIKey: FPWMERDSYDEJOP-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 6-chloro-2-phenylimidazo[1,2-b]pyridazine |
| InChIKey | FPWMERDSYDEJOP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C(=N2)C=CC(=N3)Cl |
Computed by PubChem (NCBI)