CAS 208459-81-8 appears in our catalog under these names: 4-Chloro-5-phenyl-7h-pyrrolo[2,3-d]pyrimidine, 95%, 4-Chloro-5-phenyl-7H-pyrrolo(2,3-d)pyrimidine, 95+%, 4–Chloro–5–Phenyl–7H–Pyrrolo(2,3–D)Pyrimidine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 25g, 250mg, 100mg.
4-chloro-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine (CAS 208459-81-8) is a chemical compound with the molecular formula C12H8ClN3 and a molecular weight of 229.66 g/mol. IUPAC name: 4-chloro-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: YDDOENFAKYOBJS-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 4-chloro-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | YDDOENFAKYOBJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CNC3=C2C(=NC=N3)Cl |
Computed by PubChem (NCBI)