CAS 63053-15-6 appears in our catalog under these names: 6-Chloro-2-(pyridin-2-yl)-1h-1,3-benzodiazole, 95%, 6-Chloro-2-(pyridin-2-yl)-1H-benzo(d)imidazole, 97%, 6-Chloro-2-(pyridin-2-yl)-1H-1,3-benzodiazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 2,5g.
6-chloro-2-pyridin-2-yl-1H-benzimidazole (CAS 63053-15-6) is a chemical compound with the molecular formula C12H8ClN3 and a molecular weight of 229.66 g/mol. IUPAC name: 6-chloro-2-pyridin-2-yl-1H-benzimidazole. InChIKey: AIASBFLKLNIZOK-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 6-chloro-2-pyridin-2-yl-1H-benzimidazole |
| InChIKey | AIASBFLKLNIZOK-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC3=C(N2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)