cas: 881190-95-0 — see every product listed under this CAS number, including other names
7-Chloro-6-fluoro-2,3-dihydro-1H-inden-1-one 95% (CAS 881190-95-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A385624-100mg |
| cas | 881190-95-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1460.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A385624 |
7-chloro-6-fluoro-2,3-dihydroinden-1-one (CAS 881190-95-0) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: 7-chloro-6-fluoro-2,3-dihydroinden-1-one. InChIKey: STNPXHSEDNMJFC-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | 7-chloro-6-fluoro-2,3-dihydroinden-1-one |
| InChIKey | STNPXHSEDNMJFC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2Cl)F |
Computed by PubChem (NCBI)