cas: 881190-95-0 — see every product listed under this CAS number, including other names
7-Chloro-6-fluoro-2,3-dihydro-1H-inden-1-one, 96% (CAS 881190-95-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690356-100MG |
| cas | 881190-95-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 706.02 Pln | |
| Fluorochem | 1g | 1762.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
7-chloro-6-fluoro-2,3-dihydroinden-1-one (CAS 881190-95-0) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: 7-chloro-6-fluoro-2,3-dihydroinden-1-one. InChIKey: STNPXHSEDNMJFC-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | 7-chloro-6-fluoro-2,3-dihydroinden-1-one |
| InChIKey | STNPXHSEDNMJFC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2Cl)F |
Computed by PubChem (NCBI)