cas: 881190-95-0 — see every product listed under this CAS number, including other names
7-Chloro-6-fluoro-2,3-dihydro-1H-inden-1-one, 95%, 95% (CAS 881190-95-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C6D3-100mg |
| cas | 881190-95-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1139.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-chloro-6-fluoro-2,3-dihydroinden-1-one (CAS 881190-95-0) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: 7-chloro-6-fluoro-2,3-dihydroinden-1-one. InChIKey: STNPXHSEDNMJFC-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | 7-chloro-6-fluoro-2,3-dihydroinden-1-one |
| InChIKey | STNPXHSEDNMJFC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2Cl)F |
Computed by PubChem (NCBI)