CAS 881190-95-0 appears in our catalog under these names: 7-Chloro-6-fluoro-2,3-dihydro-1H-inden-1-one, 95%, 95%, 7-Chloro-6-fluoro-2,3-dihydro-1h-inden-1-one, 95%, 7–Chloro–6–fluoro–2,3–dihydro–1H–inden–1–one, 7-Chloro-6-fluoro-2,3-dihydro-1H-inden-1-one, 7-Chloro-6-fluoro-2,3-dihydro-1H-inden-1-one 95%. Offered by: Chemat, Combi-blocks, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
7-chloro-6-fluoro-2,3-dihydroinden-1-one (CAS 881190-95-0) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: 7-chloro-6-fluoro-2,3-dihydroinden-1-one. InChIKey: STNPXHSEDNMJFC-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | 7-chloro-6-fluoro-2,3-dihydroinden-1-one |
| InChIKey | STNPXHSEDNMJFC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2Cl)F |
Computed by PubChem (NCBI)