CAS 881190-94-9 appears in our catalog under these names: 5-Chloro-6-fluoro-2,3-dihydro-1h-inden-1-one, 95%, 5–Chloro–6–fluoro–2,3–dihydro–1H–inden–1–one, 5-Chloro-6-fluoro-2,3-dihydro-1H-inden-1-one 95%, 1H-Inden-1-one, 5-chloro-6-fluoro-2,3-dihydro-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-chloro-6-fluoro-2,3-dihydroinden-1-one (CAS 881190-94-9) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: 5-chloro-6-fluoro-2,3-dihydroinden-1-one. InChIKey: JCNGXSRBMDBMDW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | 5-chloro-6-fluoro-2,3-dihydroinden-1-one |
| InChIKey | JCNGXSRBMDBMDW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)Cl)F |
Computed by PubChem (NCBI)