7-Chloroisoquinolin-3(2H)-one, 97%
cas: 1175272-80-6 — see every product listed under this CAS number, including other names
7-Chloroisoquinolin-3(2H)-one, 97% (CAS 1175272-80-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F449891-100MG |
| cas | 1175272-80-6 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 742.46 Pln | |
| Fluorochem | 1g | 1669.22 Pln | |
| Ambeed | 250mg | 726.38 Pln | |
| Ambeed | 1g | 1655.31 Pln | |
| Ambeed | 5g | 6845.12 Pln | |
| Ambeed | 10g | 8391.50 Pln | |
| Ambeed | 25g | 17692.00 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1341.20 Pln | |
| Chemat | 5g | 5877.20 Pln | |
| Chemat | 10g | 8930.00 Pln | |
| Chemat | 25g | 17800.40 Pln | |
| BLDpharm | 100mg | 436.54 Pln | |
| BLDpharm | 250mg | 775.31 Pln | |
| BLDpharm | 1g | 1780.51 Pln | |
| BLDpharm | 5g | 6051.23 Pln | |
| BLDpharm | 10g | 9044.62 Pln | |
| BLDpharm | 25g | 19068.87 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
7-chloro-2H-isoquinolin-3-one (CAS 1175272-80-6) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 7-chloro-2H-isoquinolin-3-one. InChIKey: UIIZBWHWNUSKTA-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 7-chloro-2H-isoquinolin-3-one |
| InChIKey | UIIZBWHWNUSKTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CNC(=O)C=C21)Cl |
Computed by PubChem (NCBI)