cas: 936954-09-5 — see every product listed under this CAS number, including other names
7-Ethoxy-6-nitroquinazolin-4(3H)-one, 98%, 98% (CAS 936954-09-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12UNGX-100mg |
| cas | 936954-09-5 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 765.20 Pln | |
| Chemat | 250mg | 1230.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-ethoxy-6-nitro-3H-quinazolin-4-one (CAS 936954-09-5) is a chemical compound with the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. IUPAC name: 7-ethoxy-6-nitro-3H-quinazolin-4-one. InChIKey: RKHZCGYIBIQASN-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O4 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | 7-ethoxy-6-nitro-3H-quinazolin-4-one |
| InChIKey | RKHZCGYIBIQASN-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)N=CNC2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)