Products 3187-51-7
CAS 3187-51-7 appears in our catalog under these names: 7-Methoxychroman-3-carboxylic acid, 98%, 7-Methoxychroman-3-carboxylic acid, 96%, 96%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 3187-51-7) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 7-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: SVDWMRTZSYORGU-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 7-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | SVDWMRTZSYORGU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(CO2)C(=O)O)C=C1 |
Computed by PubChem (NCBI)