7-Methoxyquinoline-3-carboxylic acid, 98%
cas: 474659-26-2 — see every product listed under this CAS number, including other names
7-Methoxyquinoline-3-carboxylic acid, 98% (CAS 474659-26-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A482557-250mg |
| cas | 474659-26-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 526.12 Pln | |
| Ambeed | 1g | 1204.75 Pln | |
| Ambeed | 5g | 5042.88 Pln | |
| BLDpharm | 250mg | 558.72 Pln | |
| BLDpharm | 1g | 1291.79 Pln | |
| BLDpharm | 5g | 5434.78 Pln | |
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 962.00 Pln | |
| Chemat | 5g | 2872.40 Pln | |
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1226.67 Pln | |
| Fluorochem | 5g | 4902.46 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
7-methoxyquinoline-3-carboxylic acid (CAS 474659-26-2) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 7-methoxyquinoline-3-carboxylic acid. InChIKey: LDMIDFLMDWSHMF-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 7-methoxyquinoline-3-carboxylic acid |
| InChIKey | LDMIDFLMDWSHMF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=C(C=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)