cas: 1260536-49-9 — see every product listed under this CAS number, including other names
7-Methylpyrrolo[2,3-b]pyridine-3-boronic acid, 97%, 97% (CAS 1260536-49-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HIT1-250mg |
| cas | 1260536-49-9 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1-methylpyrrolo[2,3-b]pyridin-5-yl)boronic acid (CAS 1260536-49-9) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (1-methylpyrrolo[2,3-b]pyridin-5-yl)boronic acid. InChIKey: DTLXTFZIXQWPCL-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (1-methylpyrrolo[2,3-b]pyridin-5-yl)boronic acid |
| InChIKey | DTLXTFZIXQWPCL-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N=C1)N(C=C2)C)(O)O |
Computed by PubChem (NCBI)