cas: 1863-21-4 — see every product listed under this CAS number, including other names
7-Phenyl-1H-indole 97% (CAS 1863-21-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A248863-250mg |
| cas | 1863-21-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 876.56 Pln | |
| Ambeed | 5g | 2834.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A248863 |
7-phenyl-1H-indole (CAS 1863-21-4) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: 7-phenyl-1H-indole. InChIKey: PIEDFMITVNDHRR-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 7-phenyl-1H-indole |
| InChIKey | PIEDFMITVNDHRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=C2NC=C3 |
Computed by PubChem (NCBI)