cas: 2454491-07-5 — see every product listed under this CAS number, including other names
7-chloro-8-methoxy-1H-pyrido[4,3-d]pyrimidine-2,4-dione, 97% (CAS 2454491-07-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch135TFB-100mg |
| cas | 2454491-07-5 |
| size | 100mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2488.40 Pln | |
| Chemat | 250mg | 3294.80 Pln | |
| Chemat | 500mg | 5450.00 Pln | |
| Chemat | 1g | 8142.80 Pln | |
| Fluorochem | 100mg | 4610.89 Pln | |
| Fluorochem | 250mg | 6115.57 Pln | |
| Fluorochem | 500mg | 9931.94 Pln | |
| Fluorochem | 1g | 14862.49 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-chloro-8-methoxy-1H-pyrido[4,3-d]pyrimidine-2,4-dione (CAS 2454491-07-5) is a chemical compound with the molecular formula C8H6ClN3O3 and a molecular weight of 227.60 g/mol. IUPAC name: 7-chloro-8-methoxy-1H-pyrido[4,3-d]pyrimidine-2,4-dione. InChIKey: WYDXMIQXQNHQIL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O3 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | 7-chloro-8-methoxy-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
| InChIKey | WYDXMIQXQNHQIL-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CN=C1Cl)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)