cas: 1261454-55-0 — see every product listed under this CAS number, including other names
7-chloroquinolin-3-ol, 95%, 95% (CAS 1261454-55-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RR7-50mg |
| cas | 1261454-55-0 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 453.20 Pln | |
| Chemat | 100mg | 678.80 Pln | |
| Chemat | 250mg | 1053.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-chloroquinolin-3-ol (CAS 1261454-55-0) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 7-chloroquinolin-3-ol. InChIKey: KFCUFKFKVHHCGF-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 7-chloroquinolin-3-ol |
| InChIKey | KFCUFKFKVHHCGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)O)Cl |
Computed by PubChem (NCBI)