cas: 1557803-97-0 — see every product listed under this CAS number, including other names
7-methoxy-1-methyl-indazole-3-carbaldehyde, 97% (CAS 1557803-97-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch138PL8-100mg |
| cas | 1557803-97-0 |
| size | 100mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1715.60 Pln | |
| Chemat | 250mg | 2267.60 Pln | |
| Chemat | 500mg | 3731.60 Pln | |
| Chemat | 1g | 5565.20 Pln | |
| Fluorochem | 100mg | 3194.73 Pln | |
| Fluorochem | 250mg | 4194.37 Pln | |
| Fluorochem | 500mg | 6792.42 Pln | |
| Fluorochem | 1g | 10145.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-methoxy-1-methylindazole-3-carbaldehyde (CAS 1557803-97-0) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 7-methoxy-1-methylindazole-3-carbaldehyde. InChIKey: KJRMZNAQHLCJSA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 7-methoxy-1-methylindazole-3-carbaldehyde |
| InChIKey | KJRMZNAQHLCJSA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2OC)C(=N1)C=O |
Computed by PubChem (NCBI)