cas: 6051-98-5 — see every product listed under this CAS number, including other names
7H-Benzo[c]fluoren-7-one, 98% (CAS 6051-98-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A626111-250mg |
| cas | 6051-98-5 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 626.25 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 189.20 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 292.14 Pln | |
| BLDpharm | 5g | 908.59 Pln | |
| Fluorochem | 1g | 242.64 Pln | |
| Fluorochem | 5g | 643.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Benzo[c]fluoren-7-one (CAS 6051-98-5) is a chemical compound with the molecular formula C17H10O and a molecular weight of 230.26 g/mol. IUPAC name: benzo[c]fluoren-7-one. InChIKey: USYWCEDYVLPNHH-UHFFFAOYSA-N.
| Molecular formula | C17H10O |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | benzo[c]fluoren-7-one |
| InChIKey | USYWCEDYVLPNHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)